C17H30O3 — CID 163128763
2-cyclohexyl-5-methoxy-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-7-ol (PubChem CID 163128763) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 2-cyclohexyl-5-methoxy-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-7-ol.
| Compound Name | 2-cyclohexyl-5-methoxy-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 163128763 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-cyclohexyl-5-methoxy-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-7-ol |
| SMILES | COC1C(C)C(O)CC2OC(C3CCCCC3)CCC21 |
| InChI | InChI=1S/C17H30O3/c1-11-14(18)10-16-13(17(11)19-2)8-9-15(20-16)12-6-4-3-5-7-12/h11-18H,3-10H2,1-2H3 |
| InChIKey | LZPUPUTUIYIYGW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |