C30H46N2 — CID 163129281
1,16-diazatricyclo[25.3.1.112,16]dotriaconta-8,12,14,23,27(31),28-hexaene (PubChem CID 163129281) has the molecular formula C30H46N2 and a molecular weight of 434.71 g/mol. Its IUPAC name is 1,16-diazatricyclo[25.3.1.112,16]dotriaconta-8,12,14,23,27(31),28-hexaene.
| Compound Name | 1,16-diazatricyclo[25.3.1.112,16]dotriaconta-8,12,14,23,27(31),28-hexaene |
|---|---|
| PubChem CID | 163129281 |
| Molecular Formula | C30H46N2 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.37 |
| IUPAC Name | 1,16-diazatricyclo[25.3.1.112,16]dotriaconta-8,12,14,23,27(31),28-hexaene |
| SMILES | C1=CN2CCCCCCC=CCCC3=CN(CC=C3)CCCCCCC=CCCC(=C1)C2 |
| InChI | InChI=1S/C30H46N2/c1-3-7-11-15-23-31-25-18-22-30(28-31)20-14-10-6-2-4-8-12-16-24-32-26-17-21-29(27-32)19-13-9-5-1/h5-6,9-10,17-18,21-22,25,27H,1-4,7-8,11-16,19-20,23-24,26,28H2 |
| InChIKey | FMYRBTVACQMBDW-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|