C23H26N2 — CID 23374061
1-[5-(8aH-quinolin-1-yl)pentyl]-8aH-quinoline (PubChem CID 23374061) has the molecular formula C23H26N2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 1-[5-(8aH-quinolin-1-yl)pentyl]-8aH-quinoline.
| Compound Name | 1-[5-(8aH-quinolin-1-yl)pentyl]-8aH-quinoline |
|---|---|
| PubChem CID | 23374061 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-[5-(8aH-quinolin-1-yl)pentyl]-8aH-quinoline |
| SMILES | C1=CC2=CC=CN(CCCCCN3C=CC=C4C=CC=CC43)C2C=C1 |
| InChI | InChI=1S/C23H26N2/c1(6-16-24-18-8-12-20-10-2-4-14-22(20)24)7-17-25-19-9-13-21-11-3-5-15-23(21)25/h2-5,8-15,18-19,22-23H,1,6-7,16-17H2 |
| InChIKey | LPBHSJACHYUFGU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|