About 1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone
1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 163133902) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone.
Analyze 1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone?
The IUPAC name of 1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone (CID 163133902) is 1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone.
What is the SMILES notation for 1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone?
The canonical SMILES for 1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone is CC(=O)N1C[C@H](C)C(C)=N1.
What is the InChIKey of 1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone?
The InChIKey is HEVJNJWHERNFBJ-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H12N2O/c1-5-4-9(7(3)10)8-6(5)2/h5H,4H2,1-3H3/t5-/m0/s1.
What are the key properties of 1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone?
1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone has a molecular weight of 140.19 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-4,5-dimethyl-3,4-dihydropyrazol-2-yl]ethanone is sourced from PubChem (CID 163133902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).