C37H44NO8- — CID 163137505
(14-hydroxy-5,5,9-trimethyl-14-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)methyl 6-[hydroxy(oxido)amino]-8-methoxynaphtho[1,2-e][1,3]benzodioxole-5-carboxylate (PubChem CID 163137505) has the molecular formula C37H44NO8- and a molecular weight of 630.76 g/mol. Its IUPAC name is (14-hydroxy-5,5,9-trimethyl-14-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)methyl 6-[hydroxy(oxido)amino]-8-methoxynaphtho[1,2-e][1,3]benzodioxole-5-carboxylate.
| Compound Name | (14-hydroxy-5,5,9-trimethyl-14-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)methyl 6-[hydroxy(oxido)amino]-8-methoxynaphtho[1,2-e][1,3]benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 163137505 |
| Molecular Formula | C37H44NO8- |
| Molecular Weight | 630.76 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | (14-hydroxy-5,5,9-trimethyl-14-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)methyl 6-[hydroxy(oxido)amino]-8-methoxynaphtho[1,2-e][1,3]benzodioxole-5-carboxylate |
| SMILES | COc1cccc2c1cc(N([O-])O)c1c(C(=O)OCC3(O)CC45CCC6C(C)(C)CCCC6(C)C4CCC3C5)cc3c(c12)OCO3 |
| InChI | InChI=1S/C37H44NO8/c1-34(2)12-6-13-35(3)28(34)11-14-36-17-21(9-10-29(35)36)37(40,18-36)19-44-33(39)24-16-27-32(46-20-45-27)31-22-7-5-8-26(43-4)23(22)15-25(30(24)31)38(41)42/h5,7-8,15-16,21,28-29,40-41H,6,9-14,17-20H2,1-4H3/q-1 |
| InChIKey | JYUGVJAJONCRQX-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.76 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|