C17H12NO7- — CID 163120009
6-(dihydroxyamino)-7-methoxynaphtho[2,1-g][1,3]benzodioxole-5-carboxylate (PubChem CID 163120009) has the molecular formula C17H12NO7- and a molecular weight of 342.28 g/mol. Its IUPAC name is 6-(dihydroxyamino)-7-methoxynaphtho[2,1-g][1,3]benzodioxole-5-carboxylate.
| Compound Name | 6-(dihydroxyamino)-7-methoxynaphtho[2,1-g][1,3]benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 163120009 |
| Molecular Formula | C17H12NO7- |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 6-(dihydroxyamino)-7-methoxynaphtho[2,1-g][1,3]benzodioxole-5-carboxylate |
| SMILES | COc1c(N(O)O)c2c(C(=O)[O-])cc3c(c2c2ccccc12)OCO3 |
| InChI | InChI=1S/C17H13NO7/c1-23-15-9-5-3-2-4-8(9)13-12(14(15)18(21)22)10(17(19)20)6-11-16(13)25-7-24-11/h2-6,21-22H,7H2,1H3,(H,19,20)/p-1 |
| InChIKey | JVZSEIVGJPABNF-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|