C17H32N5O11- — CID 163143520
[(2S,3R,4R,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (2R)-5-[[amino-(2-hydroxy-2-oxidohydrazinyl)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 163143520) has the molecular formula C17H32N5O11- and a molecular weight of 482.47 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (2R)-5-[[amino-(2-hydroxy-2-oxidohydrazinyl)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | [(2S,3R,4R,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (2R)-5-[[amino-(2-hydroxy-2-oxidohydrazinyl)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 163143520 |
| Molecular Formula | C17H32N5O11- |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (2R)-5-[[amino-(2-hydroxy-2-oxidohydrazinyl)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC/N=C(\N)NN([O-])O)C(=O)OC[C@@H]1O[C@H](O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H32N5O11/c1-17(2,3)33-16(28)20-8(5-4-6-19-15(18)21-22(29)30)13(26)31-7-9-10(23)11(24)12(25)14(27)32-9/h8-12,14,23-25,27,29H,4-7H2,1-3H3,(H,20,28)(H3,18,19,21)/q-1/t8-,9+,10+,11-,12+,14+/m1/s1 |
| InChIKey | BLVJKXCYVXWPKL-MTLWHYAESA-N |
| XLogP | -2.99 |
| TPSA | 251.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|