About CID 163147532
CID 163147532 (PubChem CID 163147532) has the molecular formula C38H36N2O18
and a molecular weight of 808.70 g/mol.
Molecular Properties
| Compound Name | CID 163147532 |
| PubChem CID | 163147532 |
| Molecular Formula | C38H36N2O18 |
| Molecular Weight | 808.70 g/mol |
| Exact Mass | 808.20 |
| IUPAC Name | — |
| SMILES | NC1C=CC(C2CCC3(Oc4cc5oc(-c6ccc(O)c(O)c6)cc(=O)c5c(O)c42)OC2(CC#CC4(C(=O)O)OC(OC2=O)C(O)C(O)C4O)C(O)C(O)C3O)=CN1 |
| InChI | InChI=1S/C38H36N2O18/c39-23-5-3-15(13-40-23)16-6-9-38(56-22-12-21-25(26(44)24(16)22)19(43)11-20(54-21)14-2-4-17(41)18(42)10-14)32(50)29(47)31(49)37(58-38)8-1-7-36(34(51)52)30(48)27(45)28(46)33(57-36)55-35(37)53/h2-5,10-13,16,23,27-33,40-42,44-50H,6,8-9,39H2,(H,51,52) |
| InChIKey | MDGHEBOQCSCNNX-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 341.62 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 808.70 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 19 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 163147532 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163147532?
The IUPAC name of CID 163147532 (CID 163147532) is not available.
What is the SMILES notation for CID 163147532?
The canonical SMILES for CID 163147532 is NC1C=CC(C2CCC3(Oc4cc5oc(-c6ccc(O)c(O)c6)cc(=O)c5c(O)c42)OC2(CC#CC4(C(=O)O)OC(OC2=O)C(O)C(O)C4O)C(O)C(O)C3O)=CN1.
What is the InChIKey of CID 163147532?
The InChIKey is MDGHEBOQCSCNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H36N2O18/c39-23-5-3-15(13-40-23)16-6-9-38(56-22-12-21-25(26(44)24(16)22)19(43)11-20(54-21)14-2-4-17(41)18(42)10-14)32(50)29(47)31(49)37(58-38)8-1-7-36(34(51)52)30(48)27(45)28(46)33(57-36)55-35(37)53/h2-5,10-13,16,23,27-33,40-42,44-50H,6,8-9,39H2,(H,51,52).
What are the key properties of CID 163147532?
CID 163147532 has a molecular weight of 808.70 g/mol, XLogP of -2.08, 3 rotatable bonds, 12 hydrogen bond donors, and 19 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163147532 is sourced from PubChem (CID 163147532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).