C38H36N2O18 — CID 163147532
CID 163147532 (PubChem CID 163147532) has the molecular formula C38H36N2O18 and a molecular weight of 808.70 g/mol.
| Compound Name | CID 163147532 |
|---|---|
| PubChem CID | 163147532 |
| Molecular Formula | C38H36N2O18 |
| Molecular Weight | 808.70 g/mol |
| Exact Mass | 808.20 |
| IUPAC Name | — |
| SMILES | NC1C=CC(C2CCC3(Oc4cc5oc(-c6ccc(O)c(O)c6)cc(=O)c5c(O)c42)OC2(CC#CC4(C(=O)O)OC(OC2=O)C(O)C(O)C4O)C(O)C(O)C3O)=CN1 |
| InChI | InChI=1S/C38H36N2O18/c39-23-5-3-15(13-40-23)16-6-9-38(56-22-12-21-25(26(44)24(16)22)19(43)11-20(54-21)14-2-4-17(41)18(42)10-14)32(50)29(47)31(49)37(58-38)8-1-7-36(34(51)52)30(48)27(45)28(46)33(57-36)55-35(37)53/h2-5,10-13,16,23,27-33,40-42,44-50H,6,8-9,39H2,(H,51,52) |
| InChIKey | MDGHEBOQCSCNNX-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 341.62 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.70 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|