C51H49N3O20 — CID 163170307
CID 163170307 (PubChem CID 163170307) has the molecular formula C51H49N3O20 and a molecular weight of 1023.95 g/mol.
| Compound Name | CID 163170307 |
|---|---|
| PubChem CID | 163170307 |
| Molecular Formula | C51H49N3O20 |
| Molecular Weight | 1023.95 g/mol |
| Exact Mass | 1023.29 |
| IUPAC Name | — |
| SMILES | O=C1O[C@H]2O[C@@](C(=O)O)(C#CC[C@@]13O[C@]1(Oc4cc5oc(-c6cc(O)c(O)c(CCO)c6)cc(=O)c5c(O)c4[C@@H](C4=CNC5N[C@@H]6C=CC[C@@H](C6)C5=C4)C=C1Cc1ccc[nH]1)[C@H](O)[C@@H](O)[C@@H]3O)C(O)(O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C51H49N3O20/c55-11-7-22-12-23(15-31(57)37(22)58)32-18-30(56)36-33(70-32)19-34-35(38(36)59)28(24-14-29-21-4-1-5-27(13-21)54-44(29)53-20-24)17-25(16-26-6-2-10-52-26)50(72-34)42(63)39(60)41(62)48(74-50)8-3-9-49(46(65)66)51(68,69)43(64)40(61)45(73-49)71-47(48)67/h1-2,5-6,10,12,14-15,17-21,27-28,39-45,52-55,57-64,68-69H,4,7-8,11,13,16H2,(H,65,66)/t21-,27+,28+,39-,40+,41-,42+,43+,44?,45-,48-,49+,50-/m0/s1 |
| InChIKey | VCEQZWDRKJPMKQ-PDKGKMIGSA-N |
| XLogP | -1.16 |
| TPSA | 383.88 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.95 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|