C64H65N3O23 — CID 163122634
CID 163122634 (PubChem CID 163122634) has the molecular formula C64H65N3O23 and a molecular weight of 1244.22 g/mol.
| Compound Name | CID 163122634 |
|---|---|
| PubChem CID | 163122634 |
| Molecular Formula | C64H65N3O23 |
| Molecular Weight | 1244.22 g/mol |
| Exact Mass | 1243.40 |
| IUPAC Name | — |
| SMILES | O=C(CO)C[C@@H](CO)C[C@]12OC(=O)[C@@]3(CC#C[C@](C(=O)O)(O1)C(O)(O)[C@H](O)[C@H]2O)O[C@@]12Oc4cc5oc(-c6cc(O)c(O)c(CCO)c6)cc(=O)c5c(O)c4[C@@H](C4=CNC5N[C@@H]6C=CC[C@@H](C6)C5=C4)C=C1Cc1[nH]ccc1C#CC1(CCCC1)[C@]3(O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C64H65N3O23/c68-16-9-33-18-34(21-43(73)49(33)74)44-24-42(72)48-45(86-44)25-46-47(50(48)75)39(35-20-40-32-5-3-6-37(19-32)67-55(40)66-27-35)22-36-23-41-31(8-15-65-41)7-14-58(10-1-2-11-58)63(83)53(78)52(77)62(36,87-46)90-60(63)13-4-12-59(56(80)81)64(84,85)54(79)51(76)61(89-59,88-57(60)82)26-30(28-69)17-38(71)29-70/h3,6,8,15,18,20-22,24-25,27,30,32,37,39,51-55,65-70,73-79,83-85H,1-2,5,9-11,13,16-17,19,23,26,28-29H2,(H,80,81)/t30-,32+,37-,39-,51-,52-,53-,54-,55?,59-,60-,61+,62+,63-/m1/s1 |
| InChIKey | CBBWOJQOZWEZFD-SDNSLBBISA-N |
| XLogP | -0.54 |
| TPSA | 441.41 Ų |
| H-Bond Donors | 17 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 90 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1244.22 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 17 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|