C58H63N3O22 — CID 163130085
CID 163130085 (PubChem CID 163130085) has the molecular formula C58H63N3O22 and a molecular weight of 1154.14 g/mol.
| Compound Name | CID 163130085 |
|---|---|
| PubChem CID | 163130085 |
| Molecular Formula | C58H63N3O22 |
| Molecular Weight | 1154.14 g/mol |
| Exact Mass | 1153.39 |
| IUPAC Name | — |
| SMILES | CCC1=C([C@H]2C=C(Cc3ccc[nH]3)[C@]3(Oc4cc5oc(-c6cc(O)c(O)c(CCO)c6)cc(=O)c5c(O)c42)O[C@@]2(CC#C[C@]4(C(=O)O)O[C@](C[C@H](CO)CC=O)(OC2=O)[C@H](O)[C@@H](O)C4(O)O)[C@@H](O)[C@H](O)[C@H]3O)C=C2C(N1)N[C@@H]1CCC[C@H]2C1 |
| InChI | InChI=1S/C58H63N3O22/c1-2-36-34(21-33-27-6-3-7-32(17-27)60-51(33)61-36)35-20-30(19-31-8-4-13-59-31)57(80-41-23-40-43(45(68)42(35)41)37(65)22-39(79-40)29-16-28(10-15-63)44(67)38(66)18-29)48(71)46(69)47(70)54(82-57)11-5-12-55(52(74)75)58(77,78)50(73)49(72)56(83-55,81-53(54)76)24-26(25-64)9-14-62/h4,8,13-14,16,18,20-23,26-27,32,35,46-51,59-61,63-64,66-73,77-78H,2-3,6-7,9-11,15,17,19,24-25H2,1H3,(H,74,75)/t26-,27+,32-,35-,46+,47+,48-,49-,50-,51?,54+,55-,56+,57+/m1/s1 |
| InChIKey | FUNYHUZXAKVYAU-RSAPRUEJSA-N |
| XLogP | -0.19 |
| TPSA | 421.18 Ų |
| H-Bond Donors | 16 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1154.14 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 16 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|