C56H55N3O19 — CID 163129843
CID 163129843 (PubChem CID 163129843) has the molecular formula C56H55N3O19 and a molecular weight of 1074.06 g/mol.
| Compound Name | CID 163129843 |
|---|---|
| PubChem CID | 163129843 |
| Molecular Formula | C56H55N3O19 |
| Molecular Weight | 1074.06 g/mol |
| Exact Mass | 1073.34 |
| IUPAC Name | — |
| SMILES | C[C@H]1CCNC2NC=C([C@@H]3C=C4Cc5[nH]ccc5C#CC5(CCCC5)[C@]5(O)[C@H](O)[C@@H](O)[C@@]4(Oc4cc6oc(-c7cc(O)c(O)c(CCO)c7)cc(=O)c6c(O)c43)O[C@@]53CC#C[C@]4(C(=O)O)O[C@H](OC3=O)[C@H](O)[C@@H](O)[C@@H]4O)C=C21 |
| InChI | InChI=1S/C56H55N3O19/c1-25-6-14-58-48-31(25)18-29(24-59-48)32-20-30-21-33-26(7-15-57-33)5-13-52(9-2-3-10-52)56(73)47(69)46(68)55(30,78-54(56)12-4-11-53(50(70)71)45(67)43(65)44(66)49(77-53)75-51(54)72)76-38-23-37-40(42(64)39(32)38)34(61)22-36(74-37)28-17-27(8-16-60)41(63)35(62)19-28/h7,15,17-20,22-25,32,43-49,57-60,62-69,73H,2-3,6,8-10,12,14,16,21H2,1H3,(H,70,71)/t25-,32-,43+,44+,45-,46+,47+,48?,49-,53-,54+,55-,56+/m0/s1 |
| InChIKey | FSLIZEDZNNBGNT-ZKFRVQDGSA-N |
| XLogP | 0.51 |
| TPSA | 363.65 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1074.06 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|