C47H47N3O20 — CID 163177405
CID 163177405 (PubChem CID 163177405) has the molecular formula C47H47N3O20 and a molecular weight of 973.89 g/mol.
| Compound Name | CID 163177405 |
|---|---|
| PubChem CID | 163177405 |
| Molecular Formula | C47H47N3O20 |
| Molecular Weight | 973.89 g/mol |
| Exact Mass | 973.28 |
| IUPAC Name | — |
| SMILES | CCC1=CC([C@H]2C=C(Cc3ccc[nH]3)[C@]3(Oc4cc5oc(-c6cc(O)c(O)c(CCO)c6)cc(=O)c5c(O)c42)O[C@@]2(CC#C[C@]4(C(=O)O)O[C@H](OC2=O)[C@H](O)[C@@H](O)C4(O)O)[C@@H](O)[C@H](O)[C@H]3O)=CNC1N |
| InChI | InChI=1S/C47H47N3O20/c1-2-19-11-22(18-50-40(19)48)25-15-23(14-24-5-3-9-49-24)46(68-30-17-29-32(34(55)31(25)30)26(52)16-28(66-29)21-12-20(6-10-51)33(54)27(53)13-21)38(59)35(56)37(58)44(70-46)7-4-8-45(42(61)62)47(64,65)39(60)36(57)41(69-45)67-43(44)63/h3,5,9,11-13,15-18,25,35-41,49-51,53-60,64-65H,2,6-7,10,14,48H2,1H3,(H,61,62)/t25-,35+,36-,37+,38-,39-,40?,41+,44+,45-,46+/m1/s1 |
| InChIKey | XUSUNXLJZPKJEN-LNEZJKMGSA-N |
| XLogP | -1.73 |
| TPSA | 397.87 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.89 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|