C25H39NO5S — CID 163152359
[4b,8,8,10a-tetramethyl-10-[2-(5-oxo-1,2-dihydropyrrol-3-yl)ethyl]-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]methyl hydrogen sulfate (PubChem CID 163152359) has the molecular formula C25H39NO5S and a molecular weight of 465.66 g/mol. Its IUPAC name is [4b,8,8,10a-tetramethyl-10-[2-(5-oxo-1,2-dihydropyrrol-3-yl)ethyl]-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]methyl hydrogen sulfate.
| Compound Name | [4b,8,8,10a-tetramethyl-10-[2-(5-oxo-1,2-dihydropyrrol-3-yl)ethyl]-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 163152359 |
| Molecular Formula | C25H39NO5S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | [4b,8,8,10a-tetramethyl-10-[2-(5-oxo-1,2-dihydropyrrol-3-yl)ethyl]-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-ylidene]methyl hydrogen sulfate |
| SMILES | CC1(C)CCCC2(C)C1CC(CCC1=CC(=O)NC1)C1(C)CC(=COS(=O)(=O)O)CCC12 |
| InChI | InChI=1S/C25H39NO5S/c1-23(2)10-5-11-24(3)20-9-7-18(16-31-32(28,29)30)14-25(20,4)19(13-21(23)24)8-6-17-12-22(27)26-15-17/h12,16,19-21H,5-11,13-15H2,1-4H3,(H,26,27)(H,28,29,30) |
| InChIKey | NUWVEGQCSAYYIS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|