C9H9ClN3O3S- — CID 163156278
N-[[2-chloro-5-[hydroxy(oxido)amino]phenyl]carbamothioyl]acetamide (PubChem CID 163156278) has the molecular formula C9H9ClN3O3S- and a molecular weight of 274.71 g/mol. Its IUPAC name is N-[[2-chloro-5-[hydroxy(oxido)amino]phenyl]carbamothioyl]acetamide.
| Compound Name | N-[[2-chloro-5-[hydroxy(oxido)amino]phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 163156278 |
| Molecular Formula | C9H9ClN3O3S- |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | N-[[2-chloro-5-[hydroxy(oxido)amino]phenyl]carbamothioyl]acetamide |
| SMILES | CC(=O)NC(=S)Nc1cc(N([O-])O)ccc1Cl |
| InChI | InChI=1S/C9H9ClN3O3S/c1-5(14)11-9(17)12-8-4-6(13(15)16)2-3-7(8)10/h2-4,15H,1H3,(H2,11,12,14,17)/q-1 |
| InChIKey | BTMVCBGSTIHOIB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|