C21H27ClN2 — CID 163164775
[(8R,9S,10R)-8-chloro-9-ethenyl-6,6,9-trimethyl-5,6a,7,8,10,10a-hexahydroindeno[2,1-b]indol-10-yl]-methanidylazanium (PubChem CID 163164775) has the molecular formula C21H27ClN2 and a molecular weight of 342.91 g/mol. Its IUPAC name is [(8R,9S,10R)-8-chloro-9-ethenyl-6,6,9-trimethyl-5,6a,7,8,10,10a-hexahydroindeno[2,1-b]indol-10-yl]-methanidylazanium.
| Compound Name | [(8R,9S,10R)-8-chloro-9-ethenyl-6,6,9-trimethyl-5,6a,7,8,10,10a-hexahydroindeno[2,1-b]indol-10-yl]-methanidylazanium |
|---|---|
| PubChem CID | 163164775 |
| Molecular Formula | C21H27ClN2 |
| Molecular Weight | 342.91 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | [(8R,9S,10R)-8-chloro-9-ethenyl-6,6,9-trimethyl-5,6a,7,8,10,10a-hexahydroindeno[2,1-b]indol-10-yl]-methanidylazanium |
| SMILES | C=C[C@]1(C)[C@H](Cl)CC2C(c3c([nH]c4ccccc34)C2(C)C)[C@H]1[NH2+][CH2-] |
| InChI | InChI=1S/C21H27ClN2/c1-6-21(4)15(22)11-13-17(19(21)23-5)16-12-9-7-8-10-14(12)24-18(16)20(13,2)3/h6-10,13,15,17,19,24H,1,5,11,23H2,2-4H3/t13?,15-,17?,19-,21-/m1/s1 |
| InChIKey | SHKKHCAZHNAEIR-SGXRVWAESA-N |
| XLogP | 4.09 |
| TPSA | 32.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.91 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|