C21H23ClN2 — CID 162873575
8-chloro-9-ethenyl-6,6,9-trimethyl-5,6a,7,8,10,10a-hexahydroindeno[2,1-b]indole-10-carbonitrile (PubChem CID 162873575) has the molecular formula C21H23ClN2 and a molecular weight of 338.88 g/mol. Its IUPAC name is 8-chloro-9-ethenyl-6,6,9-trimethyl-5,6a,7,8,10,10a-hexahydroindeno[2,1-b]indole-10-carbonitrile.
| Compound Name | 8-chloro-9-ethenyl-6,6,9-trimethyl-5,6a,7,8,10,10a-hexahydroindeno[2,1-b]indole-10-carbonitrile |
|---|---|
| PubChem CID | 162873575 |
| Molecular Formula | C21H23ClN2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 8-chloro-9-ethenyl-6,6,9-trimethyl-5,6a,7,8,10,10a-hexahydroindeno[2,1-b]indole-10-carbonitrile |
| SMILES | C=CC1(C)C(Cl)CC2C(c3c([nH]c4ccccc34)C2(C)C)C1C#N |
| InChI | InChI=1S/C21H23ClN2/c1-5-21(4)14(11-23)18-13(10-16(21)22)20(2,3)19-17(18)12-8-6-7-9-15(12)24-19/h5-9,13-14,16,18,24H,1,10H2,2-4H3 |
| InChIKey | VWZOCUAKWZEMMP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|