C17H34N3+ — CID 163165209
3-cyclohexyl-2-N,2-N-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2,4-diamine (PubChem CID 163165209) has the molecular formula C17H34N3+ and a molecular weight of 280.48 g/mol. Its IUPAC name is 3-cyclohexyl-2-N,2-N-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2,4-diamine.
| Compound Name | 3-cyclohexyl-2-N,2-N-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2,4-diamine |
|---|---|
| PubChem CID | 163165209 |
| Molecular Formula | C17H34N3+ |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.27 |
| IUPAC Name | 3-cyclohexyl-2-N,2-N-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2,4-diamine |
| SMILES | CN(C)C1[NH2+]C2CCCCC2C(N)C1C1CCCCC1 |
| InChI | InChI=1S/C17H33N3/c1-20(2)17-15(12-8-4-3-5-9-12)16(18)13-10-6-7-11-14(13)19-17/h12-17,19H,3-11,18H2,1-2H3/p+1 |
| InChIKey | JMYKJJHDZGHPTJ-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 45.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |