C15H15N3O5 — CID 163166214
5-amino-2-[(3-hydroxyquinoline-2-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 163166214) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is 5-amino-2-[(3-hydroxyquinoline-2-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(3-hydroxyquinoline-2-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 163166214 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 5-amino-2-[(3-hydroxyquinoline-2-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)c1nc2ccccc2cc1O)C(=O)O |
| InChI | InChI=1S/C15H15N3O5/c16-12(20)6-5-10(15(22)23)18-14(21)13-11(19)7-8-3-1-2-4-9(8)17-13/h1-4,7,10,19H,5-6H2,(H2,16,20)(H,18,21)(H,22,23) |
| InChIKey | SUYSEAZIUVYHDG-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |