C26H48O5 — CID 163175029
6-(4-butoxy-3-methoxycyclohexyl)-4,8-diethoxy-1,3-dimethyl-3,3a,4,5,6,7,8,8a-octahydro-1H-cyclohepta[c]furan (PubChem CID 163175029) has the molecular formula C26H48O5 and a molecular weight of 440.67 g/mol. Its IUPAC name is 6-(4-butoxy-3-methoxycyclohexyl)-4,8-diethoxy-1,3-dimethyl-3,3a,4,5,6,7,8,8a-octahydro-1H-cyclohepta[c]furan.
| Compound Name | 6-(4-butoxy-3-methoxycyclohexyl)-4,8-diethoxy-1,3-dimethyl-3,3a,4,5,6,7,8,8a-octahydro-1H-cyclohepta[c]furan |
|---|---|
| PubChem CID | 163175029 |
| Molecular Formula | C26H48O5 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | 6-(4-butoxy-3-methoxycyclohexyl)-4,8-diethoxy-1,3-dimethyl-3,3a,4,5,6,7,8,8a-octahydro-1H-cyclohepta[c]furan |
| SMILES | CCCCOC1CCC(C2CC(OCC)C3C(C)OC(C)C3C(OCC)C2)CC1OC |
| InChI | InChI=1S/C26H48O5/c1-7-10-13-30-21-12-11-19(14-22(21)27-6)20-15-23(28-8-2)25-17(4)31-18(5)26(25)24(16-20)29-9-3/h17-26H,7-16H2,1-6H3 |
| InChIKey | MKRKSDPERCTHBN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|