C22H19N5O4 — CID 163177552
N-hydroxy-2,5-bis[2-(phenylhydrazinylidene)acetyl]benzeneamine oxide (PubChem CID 163177552) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is N-hydroxy-2,5-bis[2-(phenylhydrazinylidene)acetyl]benzeneamine oxide.
| Compound Name | N-hydroxy-2,5-bis[2-(phenylhydrazinylidene)acetyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163177552 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-hydroxy-2,5-bis[2-(phenylhydrazinylidene)acetyl]benzeneamine oxide |
| SMILES | O=C(C=NNc1ccccc1)c1ccc(C(=O)C=NNc2ccccc2)c([NH+]([O-])O)c1 |
| InChI | InChI=1S/C22H19N5O4/c28-21(14-23-25-17-7-3-1-4-8-17)16-11-12-19(20(13-16)27(30)31)22(29)15-24-26-18-9-5-2-6-10-18/h1-15,25-27,30H |
| InChIKey | XWGIAVWDYNWBSE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|