C32H42N4O7 — CID 163179196
(5R,7S)-1-[5-[[3-[[5-(diaminomethyl)-2-(hydroxymethyl)phenyl]methyl]-6H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-2,4-dihydroxyphenyl]-5,7-dihydroxydecan-3-one (PubChem CID 163179196) has the molecular formula C32H42N4O7 and a molecular weight of 594.71 g/mol. Its IUPAC name is (5R,7S)-1-[5-[[3-[[5-(diaminomethyl)-2-(hydroxymethyl)phenyl]methyl]-6H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-2,4-dihydroxyphenyl]-5,7-dihydroxydecan-3-one.
| Compound Name | (5R,7S)-1-[5-[[3-[[5-(diaminomethyl)-2-(hydroxymethyl)phenyl]methyl]-6H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-2,4-dihydroxyphenyl]-5,7-dihydroxydecan-3-one |
|---|---|
| PubChem CID | 163179196 |
| Molecular Formula | C32H42N4O7 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | (5R,7S)-1-[5-[[3-[[5-(diaminomethyl)-2-(hydroxymethyl)phenyl]methyl]-6H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]-2,4-dihydroxyphenyl]-5,7-dihydroxydecan-3-one |
| SMILES | CCC[C@H](O)C[C@@H](O)CC(=O)CCc1cc(OCN2C=C3C(Cc4cc(C(N)N)ccc4CO)=CN=C3C2)c(O)cc1O |
| InChI | InChI=1S/C32H42N4O7/c1-2-3-24(38)11-26(40)12-25(39)7-6-19-10-31(30(42)13-29(19)41)43-18-36-15-27-23(14-35-28(27)16-36)9-22-8-20(32(33)34)4-5-21(22)17-37/h4-5,8,10,13-15,24,26,32,37-38,40-42H,2-3,6-7,9,11-12,16-18,33-34H2,1H3/t24-,26+/m0/s1 |
| InChIKey | YLDQUNJGTRJNFX-AZGAKELHSA-N |
| XLogP | 2.43 |
| TPSA | 195.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|