C22H28O8 — CID 163098884
(5R,7S)-7-(3,4-dihydroxyphenyl)-5,8-dihydroxy-1-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]octan-3-one (PubChem CID 163098884) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is (5R,7S)-7-(3,4-dihydroxyphenyl)-5,8-dihydroxy-1-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]octan-3-one.
| Compound Name | (5R,7S)-7-(3,4-dihydroxyphenyl)-5,8-dihydroxy-1-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]octan-3-one |
|---|---|
| PubChem CID | 163098884 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (5R,7S)-7-(3,4-dihydroxyphenyl)-5,8-dihydroxy-1-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]octan-3-one |
| SMILES | COc1cc(CCC(=O)C[C@H](O)C[C@H](CO)c2ccc(O)c(O)c2)c(CO)cc1O |
| InChI | InChI=1S/C22H28O8/c1-30-22-9-14(16(12-24)8-21(22)29)2-4-17(25)10-18(26)6-15(11-23)13-3-5-19(27)20(28)7-13/h3,5,7-9,15,18,23-24,26-29H,2,4,6,10-12H2,1H3/t15-,18-/m1/s1 |
| InChIKey | DACGNZQXVONUJF-CRAIPNDOSA-N |
| XLogP | 1.72 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|