C22H21NO4 — CID 163183240
15-hydroxy-1,2-dimethyl-16-oxa-4-azahexacyclo[13.6.1.02,13.03,11.05,10.018,22]docosa-3(11),5,7,9,18(22)-pentaene-17,19-dione (PubChem CID 163183240) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 15-hydroxy-1,2-dimethyl-16-oxa-4-azahexacyclo[13.6.1.02,13.03,11.05,10.018,22]docosa-3(11),5,7,9,18(22)-pentaene-17,19-dione.
| Compound Name | 15-hydroxy-1,2-dimethyl-16-oxa-4-azahexacyclo[13.6.1.02,13.03,11.05,10.018,22]docosa-3(11),5,7,9,18(22)-pentaene-17,19-dione |
|---|---|
| PubChem CID | 163183240 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 15-hydroxy-1,2-dimethyl-16-oxa-4-azahexacyclo[13.6.1.02,13.03,11.05,10.018,22]docosa-3(11),5,7,9,18(22)-pentaene-17,19-dione |
| SMILES | CC12CCC(=O)C3=C1C(O)(CC1Cc4c([nH]c5ccccc45)C12C)OC3=O |
| InChI | InChI=1S/C22H21NO4/c1-20-8-7-15(24)16-17(20)22(26,27-19(16)25)10-11-9-13-12-5-3-4-6-14(12)23-18(13)21(11,20)2/h3-6,11,23,26H,7-10H2,1-2H3 |
| InChIKey | ZZGRSUSNBFYZJJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|