About (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+)
(benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+) (PubChem CID 163184768) has the molecular formula C13H10ClCuN3OS
and a molecular weight of 355.31 g/mol. Its IUPAC name is (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+).
Molecular Properties
| Compound Name | (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+) |
| PubChem CID | 163184768 |
| Molecular Formula | C13H10ClCuN3OS |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+) |
| SMILES | Cl[Cu+].O=C([N-]NC(=S)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C13H11N3OS.ClH.Cu/c17-12(11-7-4-8-14-9-11)15-16-13(18)10-5-2-1-3-6-10;;/h1-9H,(H2,15,16,17,18);1H;/q;;+2/p-2 |
| InChIKey | SLGSQLBTTKLQEV-UHFFFAOYSA-L |
| XLogP | 3.16 |
| TPSA | 56.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+)?
The IUPAC name of (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+) (CID 163184768) is (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+).
What is the SMILES notation for (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+)?
The canonical SMILES for (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+) is Cl[Cu+].O=C([N-]NC(=S)c1ccccc1)c1cccnc1.
What is the InChIKey of (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+)?
The InChIKey is SLGSQLBTTKLQEV-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H11N3OS.ClH.Cu/c17-12(11-7-4-8-14-9-11)15-16-13(18)10-5-2-1-3-6-10;;/h1-9H,(H2,15,16,17,18);1H;/q;;+2/p-2.
What are the key properties of (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+)?
(benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+) has a molecular weight of 355.31 g/mol, XLogP of 3.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (benzenecarbonothioylamino)-(pyridine-3-carbonyl)azanide;chlorocopper(1+) is sourced from PubChem (CID 163184768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).