C28H26O6 — CID 163188197
(E,7R)-7-[(2S)-5,7-dihydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-6-yl]-7-phenylhept-5-enoic acid (PubChem CID 163188197) has the molecular formula C28H26O6 and a molecular weight of 458.51 g/mol. Its IUPAC name is (E,7R)-7-[(2S)-5,7-dihydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-6-yl]-7-phenylhept-5-enoic acid.
| Compound Name | (E,7R)-7-[(2S)-5,7-dihydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-6-yl]-7-phenylhept-5-enoic acid |
|---|---|
| PubChem CID | 163188197 |
| Molecular Formula | C28H26O6 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (E,7R)-7-[(2S)-5,7-dihydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-6-yl]-7-phenylhept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/[C@H](c1ccccc1)c1c(O)cc2c(c1O)C(=O)C[C@@H](c1ccccc1)O2 |
| InChI | InChI=1S/C28H26O6/c29-21-17-24-27(22(30)16-23(34-24)19-12-6-2-7-13-19)28(33)26(21)20(18-10-4-1-5-11-18)14-8-3-9-15-25(31)32/h1-2,4-8,10-14,17,20,23,29,33H,3,9,15-16H2,(H,31,32)/b14-8+/t20-,23+/m1/s1 |
| InChIKey | JHLIRXZGNHHBHX-VKPJSVOQSA-N |
| XLogP | 5.75 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|