C26H32O6 — CID 163190385
(1Z,3R,4S,5Z)-3,4-bis(2,4,5-trimethoxyphenyl)cycloocta-1,5-diene (PubChem CID 163190385) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is (1Z,3R,4S,5Z)-3,4-bis(2,4,5-trimethoxyphenyl)cycloocta-1,5-diene.
| Compound Name | (1Z,3R,4S,5Z)-3,4-bis(2,4,5-trimethoxyphenyl)cycloocta-1,5-diene |
|---|---|
| PubChem CID | 163190385 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (1Z,3R,4S,5Z)-3,4-bis(2,4,5-trimethoxyphenyl)cycloocta-1,5-diene |
| SMILES | COc1cc(OC)c([C@H]2/C=C\CC/C=C\[C@H]2c2cc(OC)c(OC)cc2OC)cc1OC |
| InChI | InChI=1S/C26H32O6/c1-27-21-15-25(31-5)23(29-3)13-19(21)17-11-9-7-8-10-12-18(17)20-14-24(30-4)26(32-6)16-22(20)28-2/h9-18H,7-8H2,1-6H3/b11-9-,12-10-/t17-,18+ |
| InChIKey | JWIMEQBYSVVARU-LMHGVARYSA-N |
| XLogP | 5.51 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|