C13H18N2O3 — CID 20867435
6-(2,4,5-trimethoxyphenyl)-1,5-diazabicyclo[3.1.0]hexane (PubChem CID 20867435) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-(2,4,5-trimethoxyphenyl)-1,5-diazabicyclo[3.1.0]hexane.
| Compound Name | 6-(2,4,5-trimethoxyphenyl)-1,5-diazabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 20867435 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 6-(2,4,5-trimethoxyphenyl)-1,5-diazabicyclo[3.1.0]hexane |
| SMILES | COc1cc(OC)c(C2N3CCCN23)cc1OC |
| InChI | InChI=1S/C13H18N2O3/c1-16-10-8-12(18-3)11(17-2)7-9(10)13-14-5-4-6-15(13)14/h7-8,13H,4-6H2,1-3H3 |
| InChIKey | PSKQQSHGVLHBDP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 33.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|