C14H16O4 — CID 163191443
(1S,6R,8R,9S)-9-hydroxy-8-phenyl-2,7-dioxabicyclo[4.3.1]decan-3-one (PubChem CID 163191443) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (1S,6R,8R,9S)-9-hydroxy-8-phenyl-2,7-dioxabicyclo[4.3.1]decan-3-one.
| Compound Name | (1S,6R,8R,9S)-9-hydroxy-8-phenyl-2,7-dioxabicyclo[4.3.1]decan-3-one |
|---|---|
| PubChem CID | 163191443 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (1S,6R,8R,9S)-9-hydroxy-8-phenyl-2,7-dioxabicyclo[4.3.1]decan-3-one |
| SMILES | O=C1CC[C@@H]2C[C@H](O1)[C@H](O)[C@@H](c1ccccc1)O2 |
| InChI | InChI=1S/C14H16O4/c15-12-7-6-10-8-11(18-12)13(16)14(17-10)9-4-2-1-3-5-9/h1-5,10-11,13-14,16H,6-8H2/t10-,11+,13+,14-/m1/s1 |
| InChIKey | WGKQZSRLUUFXQK-UVLXDEKHSA-N |
| XLogP | 1.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |