C22H17N5O7S — CID 163196741
6-[(E)-[[5-acetyl-3-(4-nitrophenyl)-1,3,4-thiadiazol-2-ylidene]hydrazinylidene]methyl]-7-hydroxy-5-methoxy-2-methylchromen-4-one (PubChem CID 163196741) has the molecular formula C22H17N5O7S and a molecular weight of 495.47 g/mol. Its IUPAC name is 6-[(E)-[[5-acetyl-3-(4-nitrophenyl)-1,3,4-thiadiazol-2-ylidene]hydrazinylidene]methyl]-7-hydroxy-5-methoxy-2-methylchromen-4-one.
| Compound Name | 6-[(E)-[[5-acetyl-3-(4-nitrophenyl)-1,3,4-thiadiazol-2-ylidene]hydrazinylidene]methyl]-7-hydroxy-5-methoxy-2-methylchromen-4-one |
|---|---|
| PubChem CID | 163196741 |
| Molecular Formula | C22H17N5O7S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 6-[(E)-[[5-acetyl-3-(4-nitrophenyl)-1,3,4-thiadiazol-2-ylidene]hydrazinylidene]methyl]-7-hydroxy-5-methoxy-2-methylchromen-4-one |
| SMILES | COc1c(/C=N/N=c2sc(C(C)=O)nn2-c2ccc([N+](=O)[O-])cc2)c(O)cc2oc(C)cc(=O)c12 |
| InChI | InChI=1S/C22H17N5O7S/c1-11-8-17(30)19-18(34-11)9-16(29)15(20(19)33-3)10-23-24-22-26(25-21(35-22)12(2)28)13-4-6-14(7-5-13)27(31)32/h4-10,29H,1-3H3/b23-10+,24-22? |
| InChIKey | MFKUIXCQIYYSBW-AVDKQLOQSA-N |
| XLogP | 3.11 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|