C17H25NO8 — CID 163196890
[(2R,3S,4R,5R)-3-hydroxy-2-(hydroxymethyl)-5-(pent-4-ynoylamino)-6-propanoyloxyoxan-4-yl] propanoate (PubChem CID 163196890) has the molecular formula C17H25NO8 and a molecular weight of 371.39 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3-hydroxy-2-(hydroxymethyl)-5-(pent-4-ynoylamino)-6-propanoyloxyoxan-4-yl] propanoate.
| Compound Name | [(2R,3S,4R,5R)-3-hydroxy-2-(hydroxymethyl)-5-(pent-4-ynoylamino)-6-propanoyloxyoxan-4-yl] propanoate |
|---|---|
| PubChem CID | 163196890 |
| Molecular Formula | C17H25NO8 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [(2R,3S,4R,5R)-3-hydroxy-2-(hydroxymethyl)-5-(pent-4-ynoylamino)-6-propanoyloxyoxan-4-yl] propanoate |
| SMILES | C#CCCC(=O)N[C@H]1C(OC(=O)CC)O[C@H](CO)[C@@H](O)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C17H25NO8/c1-4-7-8-11(20)18-14-16(25-12(21)5-2)15(23)10(9-19)24-17(14)26-13(22)6-3/h1,10,14-17,19,23H,5-9H2,2-3H3,(H,18,20)/t10-,14-,15-,16-,17?/m1/s1 |
| InChIKey | SJLMCZQUONEFNV-XSDZPFEMSA-N |
| XLogP | -0.76 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|