C24H27N6O8P — CID 163204135
[2-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy]phenoxy]-(1-ethoxy-2-methyl-1-oxopropan-2-yl)imino-oxidophosphanium (PubChem CID 163204135) has the molecular formula C24H27N6O8P and a molecular weight of 558.49 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy]phenoxy]-(1-ethoxy-2-methyl-1-oxopropan-2-yl)imino-oxidophosphanium.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy]phenoxy]-(1-ethoxy-2-methyl-1-oxopropan-2-yl)imino-oxidophosphanium |
|---|---|
| PubChem CID | 163204135 |
| Molecular Formula | C24H27N6O8P |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy]phenoxy]-(1-ethoxy-2-methyl-1-oxopropan-2-yl)imino-oxidophosphanium |
| SMILES | CCOC(=O)C(C)(C)/N=[P+](\[O-])Oc1ccccc1OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H27N6O8P/c1-4-35-22(33)23(2,3)29-39(34)38-16-8-6-5-7-15(16)36-11-17-19(31)20(32)24(12-25,37-17)18-10-9-14-21(26)27-13-28-30(14)18/h5-10,13,17,19-20,31-32H,4,11H2,1-3H3,(H2,26,27,28)/t17-,19-,20-,24+/m1/s1 |
| InChIKey | PULZQFTXRAQMBJ-JSAFQYNZSA-N |
| XLogP | 0.81 |
| TPSA | 209.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|