C16H11Br2N7 — CID 163214066
6-[1-(2,4-dibromophenyl)triazol-4-yl]quinazoline-2,4-diamine (PubChem CID 163214066) has the molecular formula C16H11Br2N7 and a molecular weight of 461.12 g/mol. Its IUPAC name is 6-[1-(2,4-dibromophenyl)triazol-4-yl]quinazoline-2,4-diamine.
| Compound Name | 6-[1-(2,4-dibromophenyl)triazol-4-yl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 163214066 |
| Molecular Formula | C16H11Br2N7 |
| Molecular Weight | 461.12 g/mol |
| Exact Mass | 458.94 |
| IUPAC Name | 6-[1-(2,4-dibromophenyl)triazol-4-yl]quinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2cc(-c3cn(-c4ccc(Br)cc4Br)nn3)ccc2n1 |
| InChI | InChI=1S/C16H11Br2N7/c17-9-2-4-14(11(18)6-9)25-7-13(23-24-25)8-1-3-12-10(5-8)15(19)22-16(20)21-12/h1-7H,(H4,19,20,21,22) |
| InChIKey | ASONYOHQABINQT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.12 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |