C22H18N4OS2 — CID 163221055
N-[6-(3-amino-2-methanimidoyl-6-thiophen-3-ylphenyl)-1,3-benzothiazol-2-yl]cyclopropanecarboxamide (PubChem CID 163221055) has the molecular formula C22H18N4OS2 and a molecular weight of 418.55 g/mol. Its IUPAC name is N-[6-(3-amino-2-methanimidoyl-6-thiophen-3-ylphenyl)-1,3-benzothiazol-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[6-(3-amino-2-methanimidoyl-6-thiophen-3-ylphenyl)-1,3-benzothiazol-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 163221055 |
| Molecular Formula | C22H18N4OS2 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[6-(3-amino-2-methanimidoyl-6-thiophen-3-ylphenyl)-1,3-benzothiazol-2-yl]cyclopropanecarboxamide |
| SMILES | [H]/N=C/c1c(N)ccc(-c2ccsc2)c1-c1ccc2nc(NC(=O)C3CC3)sc2c1 |
| InChI | InChI=1S/C22H18N4OS2/c23-10-16-17(24)5-4-15(14-7-8-28-11-14)20(16)13-3-6-18-19(9-13)29-22(25-18)26-21(27)12-1-2-12/h3-12,23H,1-2,24H2,(H,25,26,27)/b23-10+ |
| InChIKey | XVELHRMLYXJWHP-AUEPDCJTSA-N |
| XLogP | 5.62 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|