C21H33FN2O3 — CID 163222634
2-[(3E,4E)-3-ethylidene-2-methyl-5-oxo-4-[(Z)-2-propan-2-ylbut-2-enylidene]pyrrolidin-1-yl]-N-methyl-5-oxopentanamide;fluoromethane (PubChem CID 163222634) has the molecular formula C21H33FN2O3 and a molecular weight of 380.50 g/mol. Its IUPAC name is 2-[(3E,4E)-3-ethylidene-2-methyl-5-oxo-4-[(Z)-2-propan-2-ylbut-2-enylidene]pyrrolidin-1-yl]-N-methyl-5-oxopentanamide;fluoromethane.
| Compound Name | 2-[(3E,4E)-3-ethylidene-2-methyl-5-oxo-4-[(Z)-2-propan-2-ylbut-2-enylidene]pyrrolidin-1-yl]-N-methyl-5-oxopentanamide;fluoromethane |
|---|---|
| PubChem CID | 163222634 |
| Molecular Formula | C21H33FN2O3 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 2-[(3E,4E)-3-ethylidene-2-methyl-5-oxo-4-[(Z)-2-propan-2-ylbut-2-enylidene]pyrrolidin-1-yl]-N-methyl-5-oxopentanamide;fluoromethane |
| SMILES | C/C=C(\C=C1\C(=O)N(C(CCC=O)C(=O)NC)C(C)\C1=C\C)C(C)C.CF |
| InChI | InChI=1S/C20H30N2O3.CH3F/c1-7-15(13(3)4)12-17-16(8-2)14(5)22(20(17)25)18(10-9-11-23)19(24)21-6;1-2/h7-8,11-14,18H,9-10H2,1-6H3,(H,21,24);1H3/b15-7+,16-8-,17-12+; |
| InChIKey | DROSZARMALRNFN-MAQIOTPYSA-N |
| XLogP | 3.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|