C20H31FN2O3 — CID 163222697
fluoromethane;N-methyl-2-[(3E)-2-methyl-3-[(Z)-2-methylhex-4-en-3-ylidene]-4-methylidene-5-oxopyrrolidin-1-yl]-5-oxopentanamide (PubChem CID 163222697) has the molecular formula C20H31FN2O3 and a molecular weight of 366.48 g/mol. Its IUPAC name is fluoromethane;N-methyl-2-[(3E)-2-methyl-3-[(Z)-2-methylhex-4-en-3-ylidene]-4-methylidene-5-oxopyrrolidin-1-yl]-5-oxopentanamide.
| Compound Name | fluoromethane;N-methyl-2-[(3E)-2-methyl-3-[(Z)-2-methylhex-4-en-3-ylidene]-4-methylidene-5-oxopyrrolidin-1-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 163222697 |
| Molecular Formula | C20H31FN2O3 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | fluoromethane;N-methyl-2-[(3E)-2-methyl-3-[(Z)-2-methylhex-4-en-3-ylidene]-4-methylidene-5-oxopyrrolidin-1-yl]-5-oxopentanamide |
| SMILES | C=C1C(=O)N(C(CCC=O)C(=O)NC)C(C)/C1=C(/C=C\C)C(C)C.CF |
| InChI | InChI=1S/C19H28N2O3.CH3F/c1-7-9-15(12(2)3)17-13(4)19(24)21(14(17)5)16(10-8-11-22)18(23)20-6;1-2/h7,9,11-12,14,16H,4,8,10H2,1-3,5-6H3,(H,20,23);1H3/b9-7-,17-15-; |
| InChIKey | WSQIFSHAKPPLHT-QFEORVJBSA-N |
| XLogP | 2.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|