C30H21N3O7S — CID 163233088
5-[[3-[(4-nitrobenzoyl)amino]-4-phenylphenyl]carbamoyl]naphthalene-2-sulfonic acid (PubChem CID 163233088) has the molecular formula C30H21N3O7S and a molecular weight of 567.58 g/mol. Its IUPAC name is 5-[[3-[(4-nitrobenzoyl)amino]-4-phenylphenyl]carbamoyl]naphthalene-2-sulfonic acid.
| Compound Name | 5-[[3-[(4-nitrobenzoyl)amino]-4-phenylphenyl]carbamoyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 163233088 |
| Molecular Formula | C30H21N3O7S |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | 5-[[3-[(4-nitrobenzoyl)amino]-4-phenylphenyl]carbamoyl]naphthalene-2-sulfonic acid |
| SMILES | O=C(Nc1cc(NC(=O)c2cccc3cc(S(=O)(=O)O)ccc23)ccc1-c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H21N3O7S/c34-29(20-9-12-23(13-10-20)33(36)37)32-28-18-22(11-15-26(28)19-5-2-1-3-6-19)31-30(35)27-8-4-7-21-17-24(41(38,39)40)14-16-25(21)27/h1-18H,(H,31,35)(H,32,34)(H,38,39,40) |
| InChIKey | OEXRWBKHIKONPE-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|