C11H25NS — CID 163259172
N,N-dimethyl-1-(thiepan-4-yl)methanamine;ethane (PubChem CID 163259172) has the molecular formula C11H25NS and a molecular weight of 203.39 g/mol. Its IUPAC name is N,N-dimethyl-1-(thiepan-4-yl)methanamine;ethane.
| Compound Name | N,N-dimethyl-1-(thiepan-4-yl)methanamine;ethane |
|---|---|
| PubChem CID | 163259172 |
| Molecular Formula | C11H25NS |
| Molecular Weight | 203.39 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N,N-dimethyl-1-(thiepan-4-yl)methanamine;ethane |
| SMILES | CC.CN(C)CC1CCCSCC1 |
| InChI | InChI=1S/C9H19NS.C2H6/c1-10(2)8-9-4-3-6-11-7-5-9;1-2/h9H,3-8H2,1-2H3;1-2H3 |
| InChIKey | CRIAGAVKIBYVIL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |