C21H31N4O5Si — CID 163263696
CID 163263696 (PubChem CID 163263696) has the molecular formula C21H31N4O5Si and a molecular weight of 447.59 g/mol.
| Compound Name | CID 163263696 |
|---|---|
| PubChem CID | 163263696 |
| Molecular Formula | C21H31N4O5Si |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | — |
| SMILES | CC(C(=O)NN)C1CC[C@@]([Si])(NC(=O)OCc2ccccc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31N4O5Si/c1-14(17(26)24-22)16-10-11-21(31,13-25(16)19(28)30-20(2,3)4)23-18(27)29-12-15-8-6-5-7-9-15/h5-9,14,16H,10-13,22H2,1-4H3,(H,23,27)(H,24,26)/t14?,16?,21-/m0/s1 |
| InChIKey | JNEFRTGGXPONPA-LGHNAOJLSA-N |
| XLogP | 1.80 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|