C29H28N2O7 — CID 163282925
3-amino-2-(9H-fluoren-1-ylmethoxycarbonyl)-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoic acid (PubChem CID 163282925) has the molecular formula C29H28N2O7 and a molecular weight of 516.55 g/mol. Its IUPAC name is 3-amino-2-(9H-fluoren-1-ylmethoxycarbonyl)-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-2-(9H-fluoren-1-ylmethoxycarbonyl)-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 163282925 |
| Molecular Formula | C29H28N2O7 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 3-amino-2-(9H-fluoren-1-ylmethoxycarbonyl)-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoic acid |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)C(N)C(C(=O)O)C(=O)OCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C29H28N2O7/c1-37-28(35)23(14-17-8-3-2-4-9-17)31-26(32)25(30)24(27(33)34)29(36)38-16-19-11-7-13-21-20-12-6-5-10-18(20)15-22(19)21/h2-13,23-25H,14-16,30H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | ZALDNKPYOFQGEC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|