C33H29N3O3 — CID 57237977
9H-fluoren-1-ylmethyl N-[1-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]-2-phenylethyl]carbamate (PubChem CID 57237977) has the molecular formula C33H29N3O3 and a molecular weight of 515.61 g/mol. Its IUPAC name is 9H-fluoren-1-ylmethyl N-[1-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]-2-phenylethyl]carbamate.
| Compound Name | 9H-fluoren-1-ylmethyl N-[1-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 57237977 |
| Molecular Formula | C33H29N3O3 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 9H-fluoren-1-ylmethyl N-[1-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]-2-phenylethyl]carbamate |
| SMILES | COc1cccc(-c2cnc(C(Cc3ccccc3)NC(=O)OCc3cccc4c3Cc3ccccc3-4)[nH]2)c1 |
| InChI | InChI=1S/C33H29N3O3/c1-38-26-14-7-12-24(18-26)31-20-34-32(35-31)30(17-22-9-3-2-4-10-22)36-33(37)39-21-25-13-8-16-28-27-15-6-5-11-23(27)19-29(25)28/h2-16,18,20,30H,17,19,21H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | XGMAAWHEXKYZAV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |