C8H19NO5S2 — CID 163287214
2-amino-4-methylsulfanylbutanoic acid;1-sulfanylpropane-1,2,3-triol (PubChem CID 163287214) has the molecular formula C8H19NO5S2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoic acid;1-sulfanylpropane-1,2,3-triol.
| Compound Name | 2-amino-4-methylsulfanylbutanoic acid;1-sulfanylpropane-1,2,3-triol |
|---|---|
| PubChem CID | 163287214 |
| Molecular Formula | C8H19NO5S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid;1-sulfanylpropane-1,2,3-triol |
| SMILES | CSCCC(N)C(=O)O.OCC(O)C(O)S |
| InChI | InChI=1S/C5H11NO2S.C3H8O3S/c1-9-3-2-4(6)5(7)8;4-1-2(5)3(6)7/h4H,2-3,6H2,1H3,(H,7,8);2-7H,1H2 |
| InChIKey | BUPBMJLDHGTDKM-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|