C11H23NO8S — CID 20832986
2-amino-4-methylsulfanylbutanoic acid;(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 20832986) has the molecular formula C11H23NO8S and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoic acid;(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | 2-amino-4-methylsulfanylbutanoic acid;(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 20832986 |
| Molecular Formula | C11H23NO8S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid;(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | CSCCC(N)C(=O)O.O=C(CO)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.C5H11NO2S/c7-1-3(9)5(11)6(12)4(10)2-8;1-9-3-2-4(6)5(7)8/h3,5-9,11-12H,1-2H2;4H,2-3,6H2,1H3,(H,7,8)/t3-,5-,6-;/m1./s1 |
| InChIKey | IINAKOHNOYKTIT-BAOOBMCLSA-N |
| XLogP | -3.23 |
| TPSA | 181.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |