C29H32N8O — CID 163288421
N-[1-[2-(dimethylamino)ethyl]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]indazol-7-yl]-3-methylbut-2-enamide (PubChem CID 163288421) has the molecular formula C29H32N8O and a molecular weight of 508.63 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]indazol-7-yl]-3-methylbut-2-enamide.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]indazol-7-yl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 163288421 |
| Molecular Formula | C29H32N8O |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]indazol-7-yl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)cc2cnn(CCN(C)C)c12 |
| InChI | InChI=1S/C29H32N8O/c1-19(2)14-27(38)33-25-16-21(15-20-17-31-37(28(20)25)13-12-35(3)4)32-29-30-11-10-24(34-29)23-18-36(5)26-9-7-6-8-22(23)26/h6-11,14-18H,12-13H2,1-5H3,(H,33,38)(H,30,32,34) |
| InChIKey | PDYPKAVVKLEPDY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|