C17H10F6N4O2S — CID 163290516
2-methylsulfonyl-4-N,6-N-bis(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine (PubChem CID 163290516) has the molecular formula C17H10F6N4O2S and a molecular weight of 448.35 g/mol. Its IUPAC name is 2-methylsulfonyl-4-N,6-N-bis(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 2-methylsulfonyl-4-N,6-N-bis(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 163290516 |
| Molecular Formula | C17H10F6N4O2S |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 2-methylsulfonyl-4-N,6-N-bis(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine |
| SMILES | CS(=O)(=O)c1nc(Nc2cc(F)c(F)c(F)c2)cc(Nc2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C17H10F6N4O2S/c1-30(28,29)17-26-13(24-7-2-9(18)15(22)10(19)3-7)6-14(27-17)25-8-4-11(20)16(23)12(21)5-8/h2-6H,1H3,(H2,24,25,26,27) |
| InChIKey | FNQATZCTMBEYEE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|