C16H14F2O4S — CID 163297767
phenyl 4-(benzenesulfonyl)-4,4-difluorobutanoate (PubChem CID 163297767) has the molecular formula C16H14F2O4S and a molecular weight of 340.35 g/mol. Its IUPAC name is phenyl 4-(benzenesulfonyl)-4,4-difluorobutanoate.
| Compound Name | phenyl 4-(benzenesulfonyl)-4,4-difluorobutanoate |
|---|---|
| PubChem CID | 163297767 |
| Molecular Formula | C16H14F2O4S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | phenyl 4-(benzenesulfonyl)-4,4-difluorobutanoate |
| SMILES | O=C(CCC(F)(F)S(=O)(=O)c1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C16H14F2O4S/c17-16(18,23(20,21)14-9-5-2-6-10-14)12-11-15(19)22-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | FVFBIDDRIOXSBT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|