C18H8Cl6O6S — CID 2774892
[4-[4-(2,3,3-trichloroprop-2-enoyloxy)phenyl]sulfonylphenyl] 2,3,3-trichloroprop-2-enoate (PubChem CID 2774892) has the molecular formula C18H8Cl6O6S and a molecular weight of 565.04 g/mol. Its IUPAC name is [4-[4-(2,3,3-trichloroprop-2-enoyloxy)phenyl]sulfonylphenyl] 2,3,3-trichloroprop-2-enoate.
| Compound Name | [4-[4-(2,3,3-trichloroprop-2-enoyloxy)phenyl]sulfonylphenyl] 2,3,3-trichloroprop-2-enoate |
|---|---|
| PubChem CID | 2774892 |
| Molecular Formula | C18H8Cl6O6S |
| Molecular Weight | 565.04 g/mol |
| Exact Mass | 561.82 |
| IUPAC Name | [4-[4-(2,3,3-trichloroprop-2-enoyloxy)phenyl]sulfonylphenyl] 2,3,3-trichloroprop-2-enoate |
| SMILES | O=C(Oc1ccc(S(=O)(=O)c2ccc(OC(=O)C(Cl)=C(Cl)Cl)cc2)cc1)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C18H8Cl6O6S/c19-13(15(21)22)17(25)29-9-1-5-11(6-2-9)31(27,28)12-7-3-10(4-8-12)30-18(26)14(20)16(23)24/h1-8H |
| InChIKey | HXYPMMAPDRFFTM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.04 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|