C9H10N2 — CID 163298156
2,3,4,5-tetrahydro-1H-indole-2-carbonitrile (PubChem CID 163298156) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-indole-2-carbonitrile.
| Compound Name | 2,3,4,5-tetrahydro-1H-indole-2-carbonitrile |
|---|---|
| PubChem CID | 163298156 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2,3,4,5-tetrahydro-1H-indole-2-carbonitrile |
| SMILES | N#CC1CC2=C(C=CCC2)N1 |
| InChI | InChI=1S/C9H10N2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h2,4,8,11H,1,3,5H2 |
| InChIKey | JVDJJGOJFRMRAI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |