C9H9BrOS — CID 163300935
8-bromo-4,5-dihydro-3,1-benzoxathiepine (PubChem CID 163300935) has the molecular formula C9H9BrOS and a molecular weight of 245.14 g/mol. Its IUPAC name is 8-bromo-4,5-dihydro-3,1-benzoxathiepine.
| Compound Name | 8-bromo-4,5-dihydro-3,1-benzoxathiepine |
|---|---|
| PubChem CID | 163300935 |
| Molecular Formula | C9H9BrOS |
| Molecular Weight | 245.14 g/mol |
| Exact Mass | 243.96 |
| IUPAC Name | 8-bromo-4,5-dihydro-3,1-benzoxathiepine |
| SMILES | Brc1ccc2c(c1)SCOCC2 |
| InChI | InChI=1S/C9H9BrOS/c10-8-2-1-7-3-4-11-6-12-9(7)5-8/h1-2,5H,3-4,6H2 |
| InChIKey | BLRDIEIPMAGVPW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.14 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |