C14H14F4N2O — CID 163316169
(3aS,6aS)-5-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one (PubChem CID 163316169) has the molecular formula C14H14F4N2O and a molecular weight of 302.27 g/mol. Its IUPAC name is (3aS,6aS)-5-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one.
| Compound Name | (3aS,6aS)-5-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 163316169 |
| Molecular Formula | C14H14F4N2O |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (3aS,6aS)-5-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
| SMILES | O=C1NC[C@H]2CN(Cc3cc(F)ccc3C(F)(F)F)C[C@@H]12 |
| InChI | InChI=1S/C14H14F4N2O/c15-10-1-2-12(14(16,17)18)8(3-10)5-20-6-9-4-19-13(21)11(9)7-20/h1-3,9,11H,4-7H2,(H,19,21)/t9-,11+/m0/s1 |
| InChIKey | SAIDFSLGNUTXCB-GXSJLCMTSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |